N-[3-tert-butyl-1-(2,4-dimethylphenyl)-1H-pyrazol-5-yl]-N~2~-[(4-ethylphenyl)carbamoyl]-N~2~-(2-methylpropyl)glycinamide
Chemical Structure Depiction of
N-[3-tert-butyl-1-(2,4-dimethylphenyl)-1H-pyrazol-5-yl]-N~2~-[(4-ethylphenyl)carbamoyl]-N~2~-(2-methylpropyl)glycinamide
N-[3-tert-butyl-1-(2,4-dimethylphenyl)-1H-pyrazol-5-yl]-N~2~-[(4-ethylphenyl)carbamoyl]-N~2~-(2-methylpropyl)glycinamide
Compound characteristics
| Compound ID: | V027-5002 |
| Compound Name: | N-[3-tert-butyl-1-(2,4-dimethylphenyl)-1H-pyrazol-5-yl]-N~2~-[(4-ethylphenyl)carbamoyl]-N~2~-(2-methylpropyl)glycinamide |
| Molecular Weight: | 503.69 |
| Molecular Formula: | C30 H41 N5 O2 |
| Salt: | not_available |
| Smiles: | CCc1ccc(cc1)NC(N(CC(C)C)CC(Nc1cc(C(C)(C)C)nn1c1ccc(C)cc1C)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 7.8437 |
| logD: | 7.8434 |
| logSw: | -5.5833 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 62.554 |
| InChI Key: | IBOVQRONDUXPEC-UHFFFAOYSA-N |