N,N-diethyl-3-{2-phenyl-6-[3-(trifluoromethyl)phenyl]imidazo[1,2-a]pyridin-3-yl}propanamide
Chemical Structure Depiction of
N,N-diethyl-3-{2-phenyl-6-[3-(trifluoromethyl)phenyl]imidazo[1,2-a]pyridin-3-yl}propanamide
N,N-diethyl-3-{2-phenyl-6-[3-(trifluoromethyl)phenyl]imidazo[1,2-a]pyridin-3-yl}propanamide
Compound characteristics
| Compound ID: | V027-5019 |
| Compound Name: | N,N-diethyl-3-{2-phenyl-6-[3-(trifluoromethyl)phenyl]imidazo[1,2-a]pyridin-3-yl}propanamide |
| Molecular Weight: | 465.52 |
| Molecular Formula: | C27 H26 F3 N3 O |
| Salt: | not_available |
| Smiles: | CCN(CC)C(CCc1c(c2ccccc2)nc2ccc(cn12)c1cccc(c1)C(F)(F)F)=O |
| Stereo: | ACHIRAL |
| logP: | 5.8471 |
| logD: | 5.8364 |
| logSw: | -5.6091 |
| Hydrogen bond acceptors count: | 3 |
| Polar surface area: | 23.631 |
| InChI Key: | XPQOZTKLRCEKBN-UHFFFAOYSA-N |