2-{2-[(2,6-dichlorophenyl)methyl]-1H-benzimidazol-1-yl}-N-[(4-fluorophenyl)methyl]acetamide
Chemical Structure Depiction of
2-{2-[(2,6-dichlorophenyl)methyl]-1H-benzimidazol-1-yl}-N-[(4-fluorophenyl)methyl]acetamide
2-{2-[(2,6-dichlorophenyl)methyl]-1H-benzimidazol-1-yl}-N-[(4-fluorophenyl)methyl]acetamide
Compound characteristics
| Compound ID: | V027-5093 |
| Compound Name: | 2-{2-[(2,6-dichlorophenyl)methyl]-1H-benzimidazol-1-yl}-N-[(4-fluorophenyl)methyl]acetamide |
| Molecular Weight: | 442.32 |
| Molecular Formula: | C23 H18 Cl2 F N3 O |
| Salt: | not_available |
| Smiles: | C(c1c(cccc1[Cl])[Cl])c1nc2ccccc2n1CC(NCc1ccc(cc1)F)=O |
| Stereo: | ACHIRAL |
| logP: | 5.607 |
| logD: | 5.5972 |
| logSw: | -5.9332 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 35.343 |
| InChI Key: | KICBRSFDMCXTJE-UHFFFAOYSA-N |