ethyl 4-[(3-{[5-(4-methylphenyl)-1,3,4-thiadiazol-2-yl]amino}-3-oxopropyl)(1-phenylethyl)amino]-4-oxobutanoate
Chemical Structure Depiction of
ethyl 4-[(3-{[5-(4-methylphenyl)-1,3,4-thiadiazol-2-yl]amino}-3-oxopropyl)(1-phenylethyl)amino]-4-oxobutanoate
ethyl 4-[(3-{[5-(4-methylphenyl)-1,3,4-thiadiazol-2-yl]amino}-3-oxopropyl)(1-phenylethyl)amino]-4-oxobutanoate
Compound characteristics
| Compound ID: | V027-5101 |
| Compound Name: | ethyl 4-[(3-{[5-(4-methylphenyl)-1,3,4-thiadiazol-2-yl]amino}-3-oxopropyl)(1-phenylethyl)amino]-4-oxobutanoate |
| Molecular Weight: | 494.61 |
| Molecular Formula: | C26 H30 N4 O4 S |
| Salt: | not_available |
| Smiles: | CCOC(CCC(N(CCC(Nc1nnc(c2ccc(C)cc2)s1)=O)C(C)c1ccccc1)=O)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 4.7533 |
| logD: | 4.753 |
| logSw: | -4.3058 |
| Hydrogen bond acceptors count: | 9 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 81.846 |
| InChI Key: | PKGOJNFEULAQMR-IBGZPJMESA-N |