2-{2-[(3,4-dichlorophenyl)methyl]-1H-benzimidazol-1-yl}-N-(2-methylpropyl)pentanamide
Chemical Structure Depiction of
2-{2-[(3,4-dichlorophenyl)methyl]-1H-benzimidazol-1-yl}-N-(2-methylpropyl)pentanamide
2-{2-[(3,4-dichlorophenyl)methyl]-1H-benzimidazol-1-yl}-N-(2-methylpropyl)pentanamide
Compound characteristics
| Compound ID: | V027-5104 |
| Compound Name: | 2-{2-[(3,4-dichlorophenyl)methyl]-1H-benzimidazol-1-yl}-N-(2-methylpropyl)pentanamide |
| Molecular Weight: | 432.39 |
| Molecular Formula: | C23 H27 Cl2 N3 O |
| Salt: | not_available |
| Smiles: | CCCC(C(NCC(C)C)=O)n1c2ccccc2nc1Cc1ccc(c(c1)[Cl])[Cl] |
| Stereo: | RACEMIC MIXTURE |
| logP: | 6.5751 |
| logD: | 6.5749 |
| logSw: | -6.1729 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 36.108 |
| InChI Key: | NTLUEOFEFBDFBL-NRFANRHFSA-N |