N-tert-butyl-2-{2-[(4-fluorophenyl)methyl]-5,6-dimethyl-1H-benzimidazol-1-yl}-2-phenylacetamide
Chemical Structure Depiction of
N-tert-butyl-2-{2-[(4-fluorophenyl)methyl]-5,6-dimethyl-1H-benzimidazol-1-yl}-2-phenylacetamide
N-tert-butyl-2-{2-[(4-fluorophenyl)methyl]-5,6-dimethyl-1H-benzimidazol-1-yl}-2-phenylacetamide
Compound characteristics
| Compound ID: | V027-5140 |
| Compound Name: | N-tert-butyl-2-{2-[(4-fluorophenyl)methyl]-5,6-dimethyl-1H-benzimidazol-1-yl}-2-phenylacetamide |
| Molecular Weight: | 443.56 |
| Molecular Formula: | C28 H30 F N3 O |
| Salt: | not_available |
| Smiles: | Cc1cc2c(cc1C)n(C(C(NC(C)(C)C)=O)c1ccccc1)c(Cc1ccc(cc1)F)n2 |
| Stereo: | RACEMIC MIXTURE |
| logP: | 6.8544 |
| logD: | 6.8528 |
| logSw: | -5.6227 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 34.696 |
| InChI Key: | FPFVAWUQTVPMRQ-AREMUKBSSA-N |