2-methyl-N-(3-methylbutyl)-N-{2-oxo-2-[4-(6-phenylpyridazin-3-yl)piperazin-1-yl]ethyl}benzamide
Chemical Structure Depiction of
2-methyl-N-(3-methylbutyl)-N-{2-oxo-2-[4-(6-phenylpyridazin-3-yl)piperazin-1-yl]ethyl}benzamide
2-methyl-N-(3-methylbutyl)-N-{2-oxo-2-[4-(6-phenylpyridazin-3-yl)piperazin-1-yl]ethyl}benzamide
Compound characteristics
| Compound ID: | V027-5456 |
| Compound Name: | 2-methyl-N-(3-methylbutyl)-N-{2-oxo-2-[4-(6-phenylpyridazin-3-yl)piperazin-1-yl]ethyl}benzamide |
| Molecular Weight: | 485.63 |
| Molecular Formula: | C29 H35 N5 O2 |
| Smiles: | CC(C)CCN(CC(N1CCN(CC1)c1ccc(c2ccccc2)nn1)=O)C(c1ccccc1C)=O |
| Stereo: | ACHIRAL |
| logP: | 4.5968 |
| logD: | 4.593 |
| logSw: | -4.3451 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 57.015 |
| InChI Key: | RSNHJXMXHGYMMK-UHFFFAOYSA-N |