4-tert-butyl-N-{2-[(4,5-dimethyl-1,3-thiazol-2-yl)amino]-2-oxoethyl}-N-(2-methylpropyl)benzamide
Chemical Structure Depiction of
4-tert-butyl-N-{2-[(4,5-dimethyl-1,3-thiazol-2-yl)amino]-2-oxoethyl}-N-(2-methylpropyl)benzamide
4-tert-butyl-N-{2-[(4,5-dimethyl-1,3-thiazol-2-yl)amino]-2-oxoethyl}-N-(2-methylpropyl)benzamide
Compound characteristics
| Compound ID: | V027-5903 |
| Compound Name: | 4-tert-butyl-N-{2-[(4,5-dimethyl-1,3-thiazol-2-yl)amino]-2-oxoethyl}-N-(2-methylpropyl)benzamide |
| Molecular Weight: | 401.57 |
| Molecular Formula: | C22 H31 N3 O2 S |
| Salt: | not_available |
| Smiles: | CC(C)CN(CC(Nc1nc(C)c(C)s1)=O)C(c1ccc(cc1)C(C)(C)C)=O |
| Stereo: | ACHIRAL |
| logP: | 5.4113 |
| logD: | 5.3405 |
| logSw: | -5.3838 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 50.222 |
| InChI Key: | MBYFXMUULZIFPR-UHFFFAOYSA-N |