2-{[1-(3,4-dichlorophenyl)-4,5-dihydro-1H-pyrrolo[1,2-a][1,4]diazepin-2(3H)-yl]methyl}phenol
Chemical Structure Depiction of
2-{[1-(3,4-dichlorophenyl)-4,5-dihydro-1H-pyrrolo[1,2-a][1,4]diazepin-2(3H)-yl]methyl}phenol
2-{[1-(3,4-dichlorophenyl)-4,5-dihydro-1H-pyrrolo[1,2-a][1,4]diazepin-2(3H)-yl]methyl}phenol
Compound characteristics
| Compound ID: | V027-5969 |
| Compound Name: | 2-{[1-(3,4-dichlorophenyl)-4,5-dihydro-1H-pyrrolo[1,2-a][1,4]diazepin-2(3H)-yl]methyl}phenol |
| Molecular Weight: | 387.31 |
| Molecular Formula: | C21 H20 Cl2 N2 O |
| Smiles: | C1CN(Cc2ccccc2O)C(c2ccc(c(c2)[Cl])[Cl])c2cccn2C1 |
| Stereo: | RACEMIC MIXTURE |
| logP: | 5.6714 |
| logD: | 5.6694 |
| logSw: | -5.7841 |
| Hydrogen bond acceptors count: | 2 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 22.4899 |
| InChI Key: | LBLXKFCYZUSRQN-OAQYLSRUSA-N |