1-{4-[6-(3-fluorophenoxy)pyrimidin-4-yl]-2-methylpiperazin-1-yl}hexan-1-one
Chemical Structure Depiction of
1-{4-[6-(3-fluorophenoxy)pyrimidin-4-yl]-2-methylpiperazin-1-yl}hexan-1-one
1-{4-[6-(3-fluorophenoxy)pyrimidin-4-yl]-2-methylpiperazin-1-yl}hexan-1-one
Compound characteristics
| Compound ID: | V027-6013 |
| Compound Name: | 1-{4-[6-(3-fluorophenoxy)pyrimidin-4-yl]-2-methylpiperazin-1-yl}hexan-1-one |
| Molecular Weight: | 386.47 |
| Molecular Formula: | C21 H27 F N4 O2 |
| Salt: | not_available |
| Smiles: | CCCCCC(N1CCN(CC1C)c1cc(ncn1)Oc1cccc(c1)F)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 4.3644 |
| logD: | 4.3644 |
| logSw: | -4.2414 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 45.031 |
| InChI Key: | DZXWTINNXKQPJY-INIZCTEOSA-N |