4-(2-fluorophenoxy)-6-[4-(2-methoxyphenyl)piperazin-1-yl]pyrimidine
Chemical Structure Depiction of
4-(2-fluorophenoxy)-6-[4-(2-methoxyphenyl)piperazin-1-yl]pyrimidine
4-(2-fluorophenoxy)-6-[4-(2-methoxyphenyl)piperazin-1-yl]pyrimidine
Compound characteristics
| Compound ID: | V027-6511 |
| Compound Name: | 4-(2-fluorophenoxy)-6-[4-(2-methoxyphenyl)piperazin-1-yl]pyrimidine |
| Molecular Weight: | 380.42 |
| Molecular Formula: | C21 H21 F N4 O2 |
| Salt: | not_available |
| Smiles: | COc1ccccc1N1CCN(CC1)c1cc(ncn1)Oc1ccccc1F |
| Stereo: | ACHIRAL |
| logP: | 4.4063 |
| logD: | 4.4063 |
| logSw: | -4.3965 |
| Hydrogen bond acceptors count: | 4 |
| Polar surface area: | 40.289 |
| InChI Key: | ZWKSDIJGDMWFPE-UHFFFAOYSA-N |