N-(5-{[(2-chlorophenyl)methyl]sulfanyl}-1,3,4-thiadiazol-2-yl)cyclobutanecarboxamide
Chemical Structure Depiction of
N-(5-{[(2-chlorophenyl)methyl]sulfanyl}-1,3,4-thiadiazol-2-yl)cyclobutanecarboxamide
N-(5-{[(2-chlorophenyl)methyl]sulfanyl}-1,3,4-thiadiazol-2-yl)cyclobutanecarboxamide
Compound characteristics
| Compound ID: | V027-6888 |
| Compound Name: | N-(5-{[(2-chlorophenyl)methyl]sulfanyl}-1,3,4-thiadiazol-2-yl)cyclobutanecarboxamide |
| Molecular Weight: | 339.86 |
| Molecular Formula: | C14 H14 Cl N3 O S2 |
| Salt: | not_available |
| Smiles: | C1CC(C1)C(Nc1nnc(SCc2ccccc2[Cl])s1)=O |
| Stereo: | ACHIRAL |
| logP: | 3.8601 |
| logD: | 3.8559 |
| logSw: | -4.1491 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 46.487 |
| InChI Key: | GCOXUEMSRZZXIY-UHFFFAOYSA-N |