N-({4-[5-(2,5-dimethoxyphenyl)-1H-imidazol-2-yl]phenyl}methyl)-2-ethoxybenzamide
Chemical Structure Depiction of
N-({4-[5-(2,5-dimethoxyphenyl)-1H-imidazol-2-yl]phenyl}methyl)-2-ethoxybenzamide
N-({4-[5-(2,5-dimethoxyphenyl)-1H-imidazol-2-yl]phenyl}methyl)-2-ethoxybenzamide
Compound characteristics
| Compound ID: | V027-7180 |
| Compound Name: | N-({4-[5-(2,5-dimethoxyphenyl)-1H-imidazol-2-yl]phenyl}methyl)-2-ethoxybenzamide |
| Molecular Weight: | 457.53 |
| Molecular Formula: | C27 H27 N3 O4 |
| Salt: | not_available |
| Smiles: | CCOc1ccccc1C(NCc1ccc(cc1)c1ncc(c2cc(ccc2OC)OC)[nH]1)=O |
| Stereo: | ACHIRAL |
| logP: | 4.5358 |
| logD: | 4.4508 |
| logSw: | -4.2404 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 66.604 |
| InChI Key: | OVUVSXKQKGQWAN-UHFFFAOYSA-N |