N-[2-(dimethylamino)ethyl]-1-[5-(3-methoxyphenyl)-1,2-oxazole-3-carbonyl]piperidine-3-carboxamide
Chemical Structure Depiction of
N-[2-(dimethylamino)ethyl]-1-[5-(3-methoxyphenyl)-1,2-oxazole-3-carbonyl]piperidine-3-carboxamide
N-[2-(dimethylamino)ethyl]-1-[5-(3-methoxyphenyl)-1,2-oxazole-3-carbonyl]piperidine-3-carboxamide
Compound characteristics
| Compound ID: | V027-7998 |
| Compound Name: | N-[2-(dimethylamino)ethyl]-1-[5-(3-methoxyphenyl)-1,2-oxazole-3-carbonyl]piperidine-3-carboxamide |
| Molecular Weight: | 400.48 |
| Molecular Formula: | C21 H28 N4 O4 |
| Salt: | not_available |
| Smiles: | CN(C)CCNC(C1CCCN(C1)C(c1cc(c2cccc(c2)OC)on1)=O)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 1.7323 |
| logD: | 0.1036 |
| logSw: | -2.1285 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 74.291 |
| InChI Key: | OUEBZIKXLJIECL-INIZCTEOSA-N |