N-[2-(dimethylamino)ethyl]-N-{[2-(dimethylamino)-5-(2-methoxyacetamido)phenyl]methyl}furan-2-carboxamide
Chemical Structure Depiction of
N-[2-(dimethylamino)ethyl]-N-{[2-(dimethylamino)-5-(2-methoxyacetamido)phenyl]methyl}furan-2-carboxamide
N-[2-(dimethylamino)ethyl]-N-{[2-(dimethylamino)-5-(2-methoxyacetamido)phenyl]methyl}furan-2-carboxamide
Compound characteristics
| Compound ID: | V027-8033 |
| Compound Name: | N-[2-(dimethylamino)ethyl]-N-{[2-(dimethylamino)-5-(2-methoxyacetamido)phenyl]methyl}furan-2-carboxamide |
| Molecular Weight: | 402.49 |
| Molecular Formula: | C21 H30 N4 O4 |
| Salt: | not_available |
| Smiles: | CN(C)CCN(Cc1cc(ccc1N(C)C)NC(COC)=O)C(c1ccco1)=O |
| Stereo: | ACHIRAL |
| logP: | 1.7093 |
| logD: | 1.1722 |
| logSw: | -2.3462 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 62.949 |
| InChI Key: | UANHQMKUZFRKMD-UHFFFAOYSA-N |