(4-methoxyphenyl){4-[3-methyl-1-(4-methylphenyl)-6-(propan-2-yl)-1H-pyrazolo[3,4-d]pyrimidin-4-yl]piperazin-1-yl}methanone
Chemical Structure Depiction of
(4-methoxyphenyl){4-[3-methyl-1-(4-methylphenyl)-6-(propan-2-yl)-1H-pyrazolo[3,4-d]pyrimidin-4-yl]piperazin-1-yl}methanone
(4-methoxyphenyl){4-[3-methyl-1-(4-methylphenyl)-6-(propan-2-yl)-1H-pyrazolo[3,4-d]pyrimidin-4-yl]piperazin-1-yl}methanone
Compound characteristics
| Compound ID: | V027-8044 |
| Compound Name: | (4-methoxyphenyl){4-[3-methyl-1-(4-methylphenyl)-6-(propan-2-yl)-1H-pyrazolo[3,4-d]pyrimidin-4-yl]piperazin-1-yl}methanone |
| Molecular Weight: | 484.6 |
| Molecular Formula: | C28 H32 N6 O2 |
| Salt: | not_available |
| Smiles: | CC(C)c1nc(c2c(C)nn(c3ccc(C)cc3)c2n1)N1CCN(CC1)C(c1ccc(cc1)OC)=O |
| Stereo: | ACHIRAL |
| logP: | 4.9261 |
| logD: | 4.4889 |
| logSw: | -4.84 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 60.975 |
| InChI Key: | YUCVFBCKHSCQGK-UHFFFAOYSA-N |