2,4-dichloro-N-(cyclopropylmethyl)-N-({2-[(3-methoxyphenyl)methanesulfonyl]-1-(2-methylpropyl)-1H-imidazol-5-yl}methyl)benzamide
Chemical Structure Depiction of
2,4-dichloro-N-(cyclopropylmethyl)-N-({2-[(3-methoxyphenyl)methanesulfonyl]-1-(2-methylpropyl)-1H-imidazol-5-yl}methyl)benzamide
2,4-dichloro-N-(cyclopropylmethyl)-N-({2-[(3-methoxyphenyl)methanesulfonyl]-1-(2-methylpropyl)-1H-imidazol-5-yl}methyl)benzamide
Compound characteristics
| Compound ID: | V027-8304 |
| Compound Name: | 2,4-dichloro-N-(cyclopropylmethyl)-N-({2-[(3-methoxyphenyl)methanesulfonyl]-1-(2-methylpropyl)-1H-imidazol-5-yl}methyl)benzamide |
| Molecular Weight: | 564.53 |
| Molecular Formula: | C27 H31 Cl2 N3 O4 S |
| Salt: | not_available |
| Smiles: | CC(C)Cn1c(CN(CC2CC2)C(c2ccc(cc2[Cl])[Cl])=O)cnc1S(Cc1cccc(c1)OC)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 5.8327 |
| logD: | 5.8327 |
| logSw: | -6.0503 |
| Hydrogen bond acceptors count: | 8 |
| Polar surface area: | 64.929 |
| InChI Key: | YCKAKARNSHTMPD-UHFFFAOYSA-N |