{2-[cyclohexyl(methyl)amino]-4-(morpholin-4-yl)-7,8-dihydropyrido[4,3-d]pyrimidin-6(5H)-yl}(4-fluorophenyl)methanone
Chemical Structure Depiction of
{2-[cyclohexyl(methyl)amino]-4-(morpholin-4-yl)-7,8-dihydropyrido[4,3-d]pyrimidin-6(5H)-yl}(4-fluorophenyl)methanone
{2-[cyclohexyl(methyl)amino]-4-(morpholin-4-yl)-7,8-dihydropyrido[4,3-d]pyrimidin-6(5H)-yl}(4-fluorophenyl)methanone
Compound characteristics
| Compound ID: | V027-8423 |
| Compound Name: | {2-[cyclohexyl(methyl)amino]-4-(morpholin-4-yl)-7,8-dihydropyrido[4,3-d]pyrimidin-6(5H)-yl}(4-fluorophenyl)methanone |
| Molecular Weight: | 453.56 |
| Molecular Formula: | C25 H32 F N5 O2 |
| Salt: | not_available |
| Smiles: | CN(C1CCCCC1)c1nc2CCN(Cc2c(n1)N1CCOCC1)C(c1ccc(cc1)F)=O |
| Stereo: | ACHIRAL |
| logP: | 3.6717 |
| logD: | 3.2133 |
| logSw: | -3.8409 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 48.848 |
| InChI Key: | OFLCWTMMLZZXMW-UHFFFAOYSA-N |