N-{1-[3-(2H-1,3-benzodioxol-5-yl)-1,2,4-oxadiazol-5-yl]-2-phenylethyl}thiophene-2-carboxamide
Chemical Structure Depiction of
N-{1-[3-(2H-1,3-benzodioxol-5-yl)-1,2,4-oxadiazol-5-yl]-2-phenylethyl}thiophene-2-carboxamide
N-{1-[3-(2H-1,3-benzodioxol-5-yl)-1,2,4-oxadiazol-5-yl]-2-phenylethyl}thiophene-2-carboxamide
Compound characteristics
| Compound ID: | V027-9806 |
| Compound Name: | N-{1-[3-(2H-1,3-benzodioxol-5-yl)-1,2,4-oxadiazol-5-yl]-2-phenylethyl}thiophene-2-carboxamide |
| Molecular Weight: | 419.46 |
| Molecular Formula: | C22 H17 N3 O4 S |
| Salt: | not_available |
| Smiles: | C(C(c1nc(c2ccc3c(c2)OCO3)no1)NC(c1cccs1)=O)c1ccccc1 |
| Stereo: | RACEMIC MIXTURE |
| logP: | 5.0712 |
| logD: | 5.0712 |
| logSw: | -5.1784 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 73.822 |
| InChI Key: | YECSFJGAPRXAPQ-INIZCTEOSA-N |