2-fluoro-N-(2-{4-[6-(4-methoxyphenyl)pyridazin-3-yl]piperazin-1-yl}-2-oxoethyl)-N-(1-phenylethyl)benzamide
Chemical Structure Depiction of
2-fluoro-N-(2-{4-[6-(4-methoxyphenyl)pyridazin-3-yl]piperazin-1-yl}-2-oxoethyl)-N-(1-phenylethyl)benzamide
2-fluoro-N-(2-{4-[6-(4-methoxyphenyl)pyridazin-3-yl]piperazin-1-yl}-2-oxoethyl)-N-(1-phenylethyl)benzamide
Compound characteristics
| Compound ID: | V028-0564 |
| Compound Name: | 2-fluoro-N-(2-{4-[6-(4-methoxyphenyl)pyridazin-3-yl]piperazin-1-yl}-2-oxoethyl)-N-(1-phenylethyl)benzamide |
| Molecular Weight: | 553.64 |
| Molecular Formula: | C32 H32 F N5 O3 |
| Salt: | not_available |
| Smiles: | CC(c1ccccc1)N(CC(N1CCN(CC1)c1ccc(c2ccc(cc2)OC)nn1)=O)C(c1ccccc1F)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 4.9295 |
| logD: | 4.9272 |
| logSw: | -4.5678 |
| Hydrogen bond acceptors count: | 7 |
| Polar surface area: | 63.673 |
| InChI Key: | DFVOEYPBOYJSQQ-QHCPKHFHSA-N |