3,4-dichloro-N-(3-methylbutyl)-N-(2-{[(5-methylfuran-2-yl)methyl](2-phenylethyl)amino}-2-oxoethyl)benzamide
Chemical Structure Depiction of
3,4-dichloro-N-(3-methylbutyl)-N-(2-{[(5-methylfuran-2-yl)methyl](2-phenylethyl)amino}-2-oxoethyl)benzamide
3,4-dichloro-N-(3-methylbutyl)-N-(2-{[(5-methylfuran-2-yl)methyl](2-phenylethyl)amino}-2-oxoethyl)benzamide
Compound characteristics
| Compound ID: | V028-0895 |
| Compound Name: | 3,4-dichloro-N-(3-methylbutyl)-N-(2-{[(5-methylfuran-2-yl)methyl](2-phenylethyl)amino}-2-oxoethyl)benzamide |
| Molecular Weight: | 515.48 |
| Molecular Formula: | C28 H32 Cl2 N2 O3 |
| Smiles: | CC(C)CCN(CC(N(CCc1ccccc1)Cc1ccc(C)o1)=O)C(c1ccc(c(c1)[Cl])[Cl])=O |
| Stereo: | ACHIRAL |
| logP: | 6.4006 |
| logD: | 6.4006 |
| logSw: | -6.2214 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 39.353 |
| InChI Key: | QNLVXUSIXIMVFZ-UHFFFAOYSA-N |