N-(2-{[2-(3,4-dimethoxyphenyl)ethyl][(5-methylfuran-2-yl)methyl]amino}-2-oxoethyl)-4-methoxy-N-(2-methylpropyl)benzamide
Chemical Structure Depiction of
N-(2-{[2-(3,4-dimethoxyphenyl)ethyl][(5-methylfuran-2-yl)methyl]amino}-2-oxoethyl)-4-methoxy-N-(2-methylpropyl)benzamide
N-(2-{[2-(3,4-dimethoxyphenyl)ethyl][(5-methylfuran-2-yl)methyl]amino}-2-oxoethyl)-4-methoxy-N-(2-methylpropyl)benzamide
Compound characteristics
| Compound ID: | V028-1275 |
| Compound Name: | N-(2-{[2-(3,4-dimethoxyphenyl)ethyl][(5-methylfuran-2-yl)methyl]amino}-2-oxoethyl)-4-methoxy-N-(2-methylpropyl)benzamide |
| Molecular Weight: | 522.64 |
| Molecular Formula: | C30 H38 N2 O6 |
| Smiles: | CC(C)CN(CC(N(CCc1ccc(c(c1)OC)OC)Cc1ccc(C)o1)=O)C(c1ccc(cc1)OC)=O |
| Stereo: | ACHIRAL |
| logP: | 4.3066 |
| logD: | 4.3066 |
| logSw: | -4.2945 |
| Hydrogen bond acceptors count: | 8 |
| Polar surface area: | 62.179 |
| InChI Key: | KRVRZBHSKCUUGU-UHFFFAOYSA-N |