N-{4-[(4-anilino-2,5-dioxo-1-phenyl-2,5-dihydro-1H-pyrrol-3-yl)sulfanyl]phenyl}furan-2-carboxamide
Chemical Structure Depiction of
N-{4-[(4-anilino-2,5-dioxo-1-phenyl-2,5-dihydro-1H-pyrrol-3-yl)sulfanyl]phenyl}furan-2-carboxamide
N-{4-[(4-anilino-2,5-dioxo-1-phenyl-2,5-dihydro-1H-pyrrol-3-yl)sulfanyl]phenyl}furan-2-carboxamide
Compound characteristics
| Compound ID: | V028-1851 |
| Compound Name: | N-{4-[(4-anilino-2,5-dioxo-1-phenyl-2,5-dihydro-1H-pyrrol-3-yl)sulfanyl]phenyl}furan-2-carboxamide |
| Molecular Weight: | 481.53 |
| Molecular Formula: | C27 H19 N3 O4 S |
| Salt: | not_available |
| Smiles: | c1ccc(cc1)NC1=C(C(N(C1=O)c1ccccc1)=O)Sc1ccc(cc1)NC(c1ccco1)=O |
| Stereo: | ACHIRAL |
| logP: | 4.2072 |
| logD: | 4.2072 |
| logSw: | -4.341 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 69.661 |
| InChI Key: | BBVZEAFBCLHJHR-UHFFFAOYSA-N |