{4-[({4-[4-(2-fluorophenyl)piperazin-1-yl]-5,6-dimethylpyrimidin-2-yl}sulfanyl)methyl]phenyl}(morpholin-4-yl)methanone
Chemical Structure Depiction of
{4-[({4-[4-(2-fluorophenyl)piperazin-1-yl]-5,6-dimethylpyrimidin-2-yl}sulfanyl)methyl]phenyl}(morpholin-4-yl)methanone
{4-[({4-[4-(2-fluorophenyl)piperazin-1-yl]-5,6-dimethylpyrimidin-2-yl}sulfanyl)methyl]phenyl}(morpholin-4-yl)methanone
Compound characteristics
| Compound ID: | V028-1920 |
| Compound Name: | {4-[({4-[4-(2-fluorophenyl)piperazin-1-yl]-5,6-dimethylpyrimidin-2-yl}sulfanyl)methyl]phenyl}(morpholin-4-yl)methanone |
| Molecular Weight: | 521.66 |
| Molecular Formula: | C28 H32 F N5 O2 S |
| Salt: | not_available |
| Smiles: | Cc1c(C)nc(nc1N1CCN(CC1)c1ccccc1F)SCc1ccc(cc1)C(N1CCOCC1)=O |
| Stereo: | ACHIRAL |
| logP: | 4.352 |
| logD: | 4.3503 |
| logSw: | -4.2321 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 48.739 |
| InChI Key: | BPHKMLLYTLMEOU-UHFFFAOYSA-N |