5-(3,5-dimethoxyphenyl)-3-[(4-nitrophenoxy)methyl]-1,2,4-oxadiazole
					Chemical Structure Depiction of
5-(3,5-dimethoxyphenyl)-3-[(4-nitrophenoxy)methyl]-1,2,4-oxadiazole
			5-(3,5-dimethoxyphenyl)-3-[(4-nitrophenoxy)methyl]-1,2,4-oxadiazole
Compound characteristics
| Compound ID: | V028-4243 | 
| Compound Name: | 5-(3,5-dimethoxyphenyl)-3-[(4-nitrophenoxy)methyl]-1,2,4-oxadiazole | 
| Molecular Weight: | 357.32 | 
| Molecular Formula: | C17 H15 N3 O6 | 
| Salt: | not_available | 
| Smiles: | COc1cc(cc(c1)OC)c1nc(COc2ccc(cc2)[N+]([O-])=O)no1 | 
| Stereo: | ACHIRAL | 
| logP: | 3.5716 | 
| logD: | 3.5716 | 
| logSw: | -3.7654 | 
| Hydrogen bond acceptors count: | 10 | 
| Polar surface area: | 88.603 | 
| InChI Key: | ACXNMUVIDYVSTH-UHFFFAOYSA-N | 
 
				 
				