5-(5-chlorothiophen-2-yl)-1-ethyl-N-[2-(thiophen-2-yl)ethyl]-1H-pyrazole-3-carboxamide
					Chemical Structure Depiction of
5-(5-chlorothiophen-2-yl)-1-ethyl-N-[2-(thiophen-2-yl)ethyl]-1H-pyrazole-3-carboxamide
			5-(5-chlorothiophen-2-yl)-1-ethyl-N-[2-(thiophen-2-yl)ethyl]-1H-pyrazole-3-carboxamide
Compound characteristics
| Compound ID: | V028-4277 | 
| Compound Name: | 5-(5-chlorothiophen-2-yl)-1-ethyl-N-[2-(thiophen-2-yl)ethyl]-1H-pyrazole-3-carboxamide | 
| Molecular Weight: | 365.9 | 
| Molecular Formula: | C16 H16 Cl N3 O S2 | 
| Salt: | not_available | 
| Smiles: | CCn1c(cc(C(NCCc2cccs2)=O)n1)c1ccc(s1)[Cl] | 
| Stereo: | ACHIRAL | 
| logP: | 3.9476 | 
| logD: | 3.9476 | 
| logSw: | -4.3031 | 
| Hydrogen bond acceptors count: | 3 | 
| Hydrogen bond donors count: | 1 | 
| Polar surface area: | 39.213 | 
| InChI Key: | MSQSZNRMKGEINB-UHFFFAOYSA-N | 
 
				 
				