N-(2,3-dichlorophenyl)-N'-(5-methyl-3-phenyl-1H-pyrazol-4-yl)urea
Chemical Structure Depiction of
N-(2,3-dichlorophenyl)-N'-(5-methyl-3-phenyl-1H-pyrazol-4-yl)urea
N-(2,3-dichlorophenyl)-N'-(5-methyl-3-phenyl-1H-pyrazol-4-yl)urea
Compound characteristics
| Compound ID: | V028-4639 |
| Compound Name: | N-(2,3-dichlorophenyl)-N'-(5-methyl-3-phenyl-1H-pyrazol-4-yl)urea |
| Molecular Weight: | 361.23 |
| Molecular Formula: | C17 H14 Cl2 N4 O |
| Salt: | not_available |
| Smiles: | Cc1c(c(c2ccccc2)n[nH]1)NC(Nc1cccc(c1[Cl])[Cl])=O |
| Stereo: | ACHIRAL |
| logP: | 4.4731 |
| logD: | 4.4697 |
| logSw: | -4.5743 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 3 |
| Polar surface area: | 54.285 |
| InChI Key: | UJEQIYOGKKTSHM-UHFFFAOYSA-N |