N-(cyclohexylmethyl)-6-(3-methoxyphenyl)imidazo[1,2-a]pyridine-2-carboxamide
Chemical Structure Depiction of
N-(cyclohexylmethyl)-6-(3-methoxyphenyl)imidazo[1,2-a]pyridine-2-carboxamide
N-(cyclohexylmethyl)-6-(3-methoxyphenyl)imidazo[1,2-a]pyridine-2-carboxamide
Compound characteristics
| Compound ID: | V028-7235 |
| Compound Name: | N-(cyclohexylmethyl)-6-(3-methoxyphenyl)imidazo[1,2-a]pyridine-2-carboxamide |
| Molecular Weight: | 363.46 |
| Molecular Formula: | C22 H25 N3 O2 |
| Salt: | not_available |
| Smiles: | COc1cccc(c1)c1ccc2nc(cn2c1)C(NCC1CCCCC1)=O |
| Stereo: | ACHIRAL |
| logP: | 5.0074 |
| logD: | 5.0074 |
| logSw: | -4.5701 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 41.676 |
| InChI Key: | RJQPDTFIHDTRAU-UHFFFAOYSA-N |