N-({2-[(2-fluorophenyl)methyl]-6,7-dimethoxy-1,2,3,4-tetrahydroisoquinolin-1-yl}methyl)-4-methylbenzamide
Chemical Structure Depiction of
N-({2-[(2-fluorophenyl)methyl]-6,7-dimethoxy-1,2,3,4-tetrahydroisoquinolin-1-yl}methyl)-4-methylbenzamide
N-({2-[(2-fluorophenyl)methyl]-6,7-dimethoxy-1,2,3,4-tetrahydroisoquinolin-1-yl}methyl)-4-methylbenzamide
Compound characteristics
| Compound ID: | V028-7939 |
| Compound Name: | N-({2-[(2-fluorophenyl)methyl]-6,7-dimethoxy-1,2,3,4-tetrahydroisoquinolin-1-yl}methyl)-4-methylbenzamide |
| Molecular Weight: | 448.54 |
| Molecular Formula: | C27 H29 F N2 O3 |
| Salt: | not_available |
| Smiles: | Cc1ccc(cc1)C(NCC1c2cc(c(cc2CCN1Cc1ccccc1F)OC)OC)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 4.1776 |
| logD: | 4.1197 |
| logSw: | -4.2111 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 43.009 |
| InChI Key: | HGDPNHPQWQNYMN-DEOSSOPVSA-N |