N-(butan-2-yl)-N-(2-{[(4-fluorophenyl)methyl][(5-methylthiophen-2-yl)methyl]amino}-2-oxoethyl)cyclobutanecarboxamide
Chemical Structure Depiction of
N-(butan-2-yl)-N-(2-{[(4-fluorophenyl)methyl][(5-methylthiophen-2-yl)methyl]amino}-2-oxoethyl)cyclobutanecarboxamide
N-(butan-2-yl)-N-(2-{[(4-fluorophenyl)methyl][(5-methylthiophen-2-yl)methyl]amino}-2-oxoethyl)cyclobutanecarboxamide
Compound characteristics
| Compound ID: | V028-7980 |
| Compound Name: | N-(butan-2-yl)-N-(2-{[(4-fluorophenyl)methyl][(5-methylthiophen-2-yl)methyl]amino}-2-oxoethyl)cyclobutanecarboxamide |
| Molecular Weight: | 430.58 |
| Molecular Formula: | C24 H31 F N2 O2 S |
| Smiles: | CCC(C)N(CC(N(Cc1ccc(cc1)F)Cc1ccc(C)s1)=O)C(C1CCC1)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 4.5029 |
| logD: | 4.5029 |
| logSw: | -4.1836 |
| Hydrogen bond acceptors count: | 4 |
| Polar surface area: | 33.003 |
| InChI Key: | ZUVQZDRBPVPGRD-KRWDZBQOSA-N |