N-{[2-(dimethylamino)-5-(ethylcarbamamido)phenyl]methyl}-N-(1-phenylethyl)thiophene-2-carboxamide
Chemical Structure Depiction of
N-{[2-(dimethylamino)-5-(ethylcarbamamido)phenyl]methyl}-N-(1-phenylethyl)thiophene-2-carboxamide
N-{[2-(dimethylamino)-5-(ethylcarbamamido)phenyl]methyl}-N-(1-phenylethyl)thiophene-2-carboxamide
Compound characteristics
| Compound ID: | V028-8104 |
| Compound Name: | N-{[2-(dimethylamino)-5-(ethylcarbamamido)phenyl]methyl}-N-(1-phenylethyl)thiophene-2-carboxamide |
| Molecular Weight: | 450.6 |
| Molecular Formula: | C25 H30 N4 O2 S |
| Salt: | not_available |
| Smiles: | CCNC(Nc1ccc(c(CN(C(C)c2ccccc2)C(c2cccs2)=O)c1)N(C)C)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 5.1907 |
| logD: | 5.1787 |
| logSw: | -4.9697 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 52.586 |
| InChI Key: | HABZYDCXGHQJNK-SFHVURJKSA-N |