1-(2-chlorophenyl)-4-(3,3-dimethylbutanoyl)-3-methylpiperazin-2-one
Chemical Structure Depiction of
1-(2-chlorophenyl)-4-(3,3-dimethylbutanoyl)-3-methylpiperazin-2-one
1-(2-chlorophenyl)-4-(3,3-dimethylbutanoyl)-3-methylpiperazin-2-one
Compound characteristics
| Compound ID: | V028-8313 |
| Compound Name: | 1-(2-chlorophenyl)-4-(3,3-dimethylbutanoyl)-3-methylpiperazin-2-one |
| Molecular Weight: | 322.83 |
| Molecular Formula: | C17 H23 Cl N2 O2 |
| Smiles: | CC1C(N(CCN1C(CC(C)(C)C)=O)c1ccccc1[Cl])=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.3179 |
| logD: | 3.3179 |
| logSw: | -3.4016 |
| Hydrogen bond acceptors count: | 4 |
| Polar surface area: | 31.4192 |
| InChI Key: | ORLIGSRMIDEYCU-LBPRGKRZSA-N |