1-[(3-bromophenyl)methyl]-5-oxo-N-[(pyridin-2-yl)methyl]pyrrolidine-3-carboxamide
Chemical Structure Depiction of
1-[(3-bromophenyl)methyl]-5-oxo-N-[(pyridin-2-yl)methyl]pyrrolidine-3-carboxamide
1-[(3-bromophenyl)methyl]-5-oxo-N-[(pyridin-2-yl)methyl]pyrrolidine-3-carboxamide
Compound characteristics
| Compound ID: | V028-8328 |
| Compound Name: | 1-[(3-bromophenyl)methyl]-5-oxo-N-[(pyridin-2-yl)methyl]pyrrolidine-3-carboxamide |
| Molecular Weight: | 388.26 |
| Molecular Formula: | C18 H18 Br N3 O2 |
| Salt: | not_available |
| Smiles: | C1C(CN(Cc2cccc(c2)[Br])C1=O)C(NCc1ccccn1)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 1.3845 |
| logD: | 1.3844 |
| logSw: | -1.9242 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 51.391 |
| InChI Key: | IZKUABNTCWSCPW-CQSZACIVSA-N |