N-(3-fluorophenyl)-5'-methyl-4'-oxo-3',4'-dihydro-1'H-spiro[piperidine-4,2'-quinazoline]-1-carboxamide
Chemical Structure Depiction of
N-(3-fluorophenyl)-5'-methyl-4'-oxo-3',4'-dihydro-1'H-spiro[piperidine-4,2'-quinazoline]-1-carboxamide
N-(3-fluorophenyl)-5'-methyl-4'-oxo-3',4'-dihydro-1'H-spiro[piperidine-4,2'-quinazoline]-1-carboxamide
Compound characteristics
| Compound ID: | V028-9240 |
| Compound Name: | N-(3-fluorophenyl)-5'-methyl-4'-oxo-3',4'-dihydro-1'H-spiro[piperidine-4,2'-quinazoline]-1-carboxamide |
| Molecular Weight: | 368.41 |
| Molecular Formula: | C20 H21 F N4 O2 |
| Salt: | not_available |
| Smiles: | Cc1cccc2c1C(NC1(CCN(CC1)C(Nc1cccc(c1)F)=O)N2)=O |
| Stereo: | ACHIRAL |
| logP: | 2.9555 |
| logD: | 2.9555 |
| logSw: | -3.2382 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 3 |
| Polar surface area: | 62.019 |
| InChI Key: | AIYWMDDCHRYCNY-UHFFFAOYSA-N |