1-{[(4-methylphenyl)methyl][2-(morpholin-4-yl)ethyl]amino}hex-5-en-2-ol
Chemical Structure Depiction of
1-{[(4-methylphenyl)methyl][2-(morpholin-4-yl)ethyl]amino}hex-5-en-2-ol
1-{[(4-methylphenyl)methyl][2-(morpholin-4-yl)ethyl]amino}hex-5-en-2-ol
Compound characteristics
| Compound ID: | V028-9561 |
| Compound Name: | 1-{[(4-methylphenyl)methyl][2-(morpholin-4-yl)ethyl]amino}hex-5-en-2-ol |
| Molecular Weight: | 332.49 |
| Molecular Formula: | C20 H32 N2 O2 |
| Salt: | not_available |
| Smiles: | Cc1ccc(CN(CCN2CCOCC2)CC(CCC=C)O)cc1 |
| Stereo: | RACEMIC MIXTURE |
| logP: | 2.6251 |
| logD: | 2.3233 |
| logSw: | -2.3791 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 32.439 |
| InChI Key: | DVFMJVWAXYBYFP-FQEVSTJZSA-N |