3-(5-nitro-1H-indol-3-yl)-3-(3-phenoxyphenyl)-1-(pyrrolidin-1-yl)propan-1-one
Chemical Structure Depiction of
3-(5-nitro-1H-indol-3-yl)-3-(3-phenoxyphenyl)-1-(pyrrolidin-1-yl)propan-1-one
3-(5-nitro-1H-indol-3-yl)-3-(3-phenoxyphenyl)-1-(pyrrolidin-1-yl)propan-1-one
Compound characteristics
| Compound ID: | V029-1578 |
| Compound Name: | 3-(5-nitro-1H-indol-3-yl)-3-(3-phenoxyphenyl)-1-(pyrrolidin-1-yl)propan-1-one |
| Molecular Weight: | 455.51 |
| Molecular Formula: | C27 H25 N3 O4 |
| Salt: | not_available |
| Smiles: | C1CCN(C1)C(CC(c1cccc(c1)Oc1ccccc1)c1c[nH]c2ccc(cc12)[N+]([O-])=O)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 5.6869 |
| logD: | 5.6869 |
| logSw: | -5.9813 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 66.454 |
| InChI Key: | CRSLXFLENLSMHP-HSZRJFAPSA-N |