N-benzyl-N-[(5-methylfuran-2-yl)methyl]-N~2~-(2-methylpropyl)-N~2~-(phenylcarbamoyl)glycinamide
Chemical Structure Depiction of
N-benzyl-N-[(5-methylfuran-2-yl)methyl]-N~2~-(2-methylpropyl)-N~2~-(phenylcarbamoyl)glycinamide
N-benzyl-N-[(5-methylfuran-2-yl)methyl]-N~2~-(2-methylpropyl)-N~2~-(phenylcarbamoyl)glycinamide
Compound characteristics
| Compound ID: | V029-1817 |
| Compound Name: | N-benzyl-N-[(5-methylfuran-2-yl)methyl]-N~2~-(2-methylpropyl)-N~2~-(phenylcarbamoyl)glycinamide |
| Molecular Weight: | 433.55 |
| Molecular Formula: | C26 H31 N3 O3 |
| Smiles: | CC(C)CN(CC(N(Cc1ccccc1)Cc1ccc(C)o1)=O)C(Nc1ccccc1)=O |
| Stereo: | ACHIRAL |
| logP: | 4.7063 |
| logD: | 4.7063 |
| logSw: | -4.2664 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 48.217 |
| InChI Key: | ZJVOLTSUMNZVDS-UHFFFAOYSA-N |