5-[(cyclopropanecarbonyl)amino]-1-[(3-fluorophenyl)methyl]-1H-indole-2-carboxamide
Chemical Structure Depiction of
5-[(cyclopropanecarbonyl)amino]-1-[(3-fluorophenyl)methyl]-1H-indole-2-carboxamide
5-[(cyclopropanecarbonyl)amino]-1-[(3-fluorophenyl)methyl]-1H-indole-2-carboxamide
Compound characteristics
| Compound ID: | V029-1925 |
| Compound Name: | 5-[(cyclopropanecarbonyl)amino]-1-[(3-fluorophenyl)methyl]-1H-indole-2-carboxamide |
| Molecular Weight: | 351.38 |
| Molecular Formula: | C20 H18 F N3 O2 |
| Salt: | not_available |
| Smiles: | C1CC1C(Nc1ccc2c(c1)cc(C(N)=O)n2Cc1cccc(c1)F)=O |
| Stereo: | ACHIRAL |
| logP: | 3.3925 |
| logD: | 3.3925 |
| logSw: | -3.6789 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 3 |
| Polar surface area: | 58.366 |
| InChI Key: | NGLLJLLFEKHLRU-UHFFFAOYSA-N |