1-(4-ethylpiperazin-1-yl)-3-{1-[(4-methylphenyl)methyl]-1H-indol-3-yl}-3-(3-phenoxyphenyl)propan-1-one
Chemical Structure Depiction of
1-(4-ethylpiperazin-1-yl)-3-{1-[(4-methylphenyl)methyl]-1H-indol-3-yl}-3-(3-phenoxyphenyl)propan-1-one
1-(4-ethylpiperazin-1-yl)-3-{1-[(4-methylphenyl)methyl]-1H-indol-3-yl}-3-(3-phenoxyphenyl)propan-1-one
Compound characteristics
| Compound ID: | V029-3396 |
| Compound Name: | 1-(4-ethylpiperazin-1-yl)-3-{1-[(4-methylphenyl)methyl]-1H-indol-3-yl}-3-(3-phenoxyphenyl)propan-1-one |
| Molecular Weight: | 557.74 |
| Molecular Formula: | C37 H39 N3 O2 |
| Salt: | not_available |
| Smiles: | CCN1CCN(CC1)C(CC(c1cccc(c1)Oc1ccccc1)c1cn(Cc2ccc(C)cc2)c2ccccc12)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 6.9767 |
| logD: | 6.6563 |
| logSw: | -5.7291 |
| Hydrogen bond acceptors count: | 4 |
| Polar surface area: | 28.1044 |
| InChI Key: | DFMSXAAXROGKLK-UUWRZZSWSA-N |