N-benzyl-3-{1-[(4-fluorophenyl)methyl]-1H-indol-3-yl}-3-(3-phenoxyphenyl)propanamide
Chemical Structure Depiction of
N-benzyl-3-{1-[(4-fluorophenyl)methyl]-1H-indol-3-yl}-3-(3-phenoxyphenyl)propanamide
N-benzyl-3-{1-[(4-fluorophenyl)methyl]-1H-indol-3-yl}-3-(3-phenoxyphenyl)propanamide
Compound characteristics
| Compound ID: | V029-4883 |
| Compound Name: | N-benzyl-3-{1-[(4-fluorophenyl)methyl]-1H-indol-3-yl}-3-(3-phenoxyphenyl)propanamide |
| Molecular Weight: | 554.67 |
| Molecular Formula: | C37 H31 F N2 O2 |
| Salt: | not_available |
| Smiles: | C(C(c1cccc(c1)Oc1ccccc1)c1cn(Cc2ccc(cc2)F)c2ccccc12)C(NCc1ccccc1)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 7.8197 |
| logD: | 7.8197 |
| logSw: | -6.2439 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 32.647 |
| InChI Key: | VJHRGGKLLZJJSI-UUWRZZSWSA-N |