4-ethyl-5-[(4-fluorophenyl)methyl]-6-[4-(methanesulfonyl)piperazin-1-yl]-2-(propan-2-yl)pyrimidine
Chemical Structure Depiction of
4-ethyl-5-[(4-fluorophenyl)methyl]-6-[4-(methanesulfonyl)piperazin-1-yl]-2-(propan-2-yl)pyrimidine
4-ethyl-5-[(4-fluorophenyl)methyl]-6-[4-(methanesulfonyl)piperazin-1-yl]-2-(propan-2-yl)pyrimidine
Compound characteristics
| Compound ID: | V029-4927 |
| Compound Name: | 4-ethyl-5-[(4-fluorophenyl)methyl]-6-[4-(methanesulfonyl)piperazin-1-yl]-2-(propan-2-yl)pyrimidine |
| Molecular Weight: | 420.55 |
| Molecular Formula: | C21 H29 F N4 O2 S |
| Salt: | not_available |
| Smiles: | CCc1c(Cc2ccc(cc2)F)c(nc(C(C)C)n1)N1CCN(CC1)S(C)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 4.2531 |
| logD: | 4.089 |
| logSw: | -4.1376 |
| Hydrogen bond acceptors count: | 7 |
| Polar surface area: | 54.472 |
| InChI Key: | GEEQCPCSYQJQOT-UHFFFAOYSA-N |