(4-{2-cyclopropyl-6-methyl-5-[(4-methylphenyl)methyl]pyrimidin-4-yl}piperazin-1-yl)(furan-2-yl)methanone
Chemical Structure Depiction of
(4-{2-cyclopropyl-6-methyl-5-[(4-methylphenyl)methyl]pyrimidin-4-yl}piperazin-1-yl)(furan-2-yl)methanone
(4-{2-cyclopropyl-6-methyl-5-[(4-methylphenyl)methyl]pyrimidin-4-yl}piperazin-1-yl)(furan-2-yl)methanone
Compound characteristics
| Compound ID: | V029-4934 |
| Compound Name: | (4-{2-cyclopropyl-6-methyl-5-[(4-methylphenyl)methyl]pyrimidin-4-yl}piperazin-1-yl)(furan-2-yl)methanone |
| Molecular Weight: | 416.52 |
| Molecular Formula: | C25 H28 N4 O2 |
| Salt: | not_available |
| Smiles: | Cc1ccc(Cc2c(C)nc(C3CC3)nc2N2CCN(CC2)C(c2ccco2)=O)cc1 |
| Stereo: | ACHIRAL |
| logP: | 4.8453 |
| logD: | 3.8515 |
| logSw: | -4.6619 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 47.787 |
| InChI Key: | PQWHTAWTZCCJPA-UHFFFAOYSA-N |