cyclobutyl[4-(6-methyl-2-phenyl-5-{[3-(trifluoromethyl)phenyl]methyl}pyrimidin-4-yl)piperazin-1-yl]methanone
Chemical Structure Depiction of
cyclobutyl[4-(6-methyl-2-phenyl-5-{[3-(trifluoromethyl)phenyl]methyl}pyrimidin-4-yl)piperazin-1-yl]methanone
cyclobutyl[4-(6-methyl-2-phenyl-5-{[3-(trifluoromethyl)phenyl]methyl}pyrimidin-4-yl)piperazin-1-yl]methanone
Compound characteristics
| Compound ID: | V029-5078 |
| Compound Name: | cyclobutyl[4-(6-methyl-2-phenyl-5-{[3-(trifluoromethyl)phenyl]methyl}pyrimidin-4-yl)piperazin-1-yl]methanone |
| Molecular Weight: | 494.56 |
| Molecular Formula: | C28 H29 F3 N4 O |
| Salt: | not_available |
| Smiles: | Cc1c(Cc2cccc(c2)C(F)(F)F)c(nc(c2ccccc2)n1)N1CCN(CC1)C(C1CCC1)=O |
| Stereo: | ACHIRAL |
| logP: | 6.3386 |
| logD: | 6.2635 |
| logSw: | -5.6384 |
| Hydrogen bond acceptors count: | 4 |
| Polar surface area: | 39.208 |
| InChI Key: | BGJHKKVOSGXSRK-UHFFFAOYSA-N |