1-[(4-tert-butylphenyl)methyl]-N-(2-methoxyethyl)-5-[4-(trifluoromethyl)benzamido]-1H-indole-2-carboxamide
Chemical Structure Depiction of
1-[(4-tert-butylphenyl)methyl]-N-(2-methoxyethyl)-5-[4-(trifluoromethyl)benzamido]-1H-indole-2-carboxamide
1-[(4-tert-butylphenyl)methyl]-N-(2-methoxyethyl)-5-[4-(trifluoromethyl)benzamido]-1H-indole-2-carboxamide
Compound characteristics
| Compound ID: | V029-5275 |
| Compound Name: | 1-[(4-tert-butylphenyl)methyl]-N-(2-methoxyethyl)-5-[4-(trifluoromethyl)benzamido]-1H-indole-2-carboxamide |
| Molecular Weight: | 551.61 |
| Molecular Formula: | C31 H32 F3 N3 O3 |
| Salt: | not_available |
| Smiles: | CC(C)(C)c1ccc(Cn2c(cc3cc(ccc23)NC(c2ccc(cc2)C(F)(F)F)=O)C(NCCOC)=O)cc1 |
| Stereo: | ACHIRAL |
| logP: | 7.0729 |
| logD: | 7.0729 |
| logSw: | -5.8066 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 56.653 |
| InChI Key: | LHGLFBCSUDBLBP-UHFFFAOYSA-N |