3-[3-(benzyloxy)phenyl]-N-[(furan-2-yl)methyl]-3-(1-methyl-1H-indol-3-yl)propanamide
Chemical Structure Depiction of
3-[3-(benzyloxy)phenyl]-N-[(furan-2-yl)methyl]-3-(1-methyl-1H-indol-3-yl)propanamide
3-[3-(benzyloxy)phenyl]-N-[(furan-2-yl)methyl]-3-(1-methyl-1H-indol-3-yl)propanamide
Compound characteristics
| Compound ID: | V029-5679 |
| Compound Name: | 3-[3-(benzyloxy)phenyl]-N-[(furan-2-yl)methyl]-3-(1-methyl-1H-indol-3-yl)propanamide |
| Molecular Weight: | 464.56 |
| Molecular Formula: | C30 H28 N2 O3 |
| Salt: | not_available |
| Smiles: | Cn1cc(C(CC(NCc2ccco2)=O)c2cccc(c2)OCc2ccccc2)c2ccccc12 |
| Stereo: | RACEMIC MIXTURE |
| logP: | 5.8519 |
| logD: | 5.8519 |
| logSw: | -5.7261 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 41.703 |
| InChI Key: | YJZDPWSOUZQAME-HHHXNRCGSA-N |