N-(2-methoxyethyl)-3-{1-[(4-methoxyphenyl)methyl]-1H-indol-3-yl}-3-(3-phenoxyphenyl)propanamide
Chemical Structure Depiction of
N-(2-methoxyethyl)-3-{1-[(4-methoxyphenyl)methyl]-1H-indol-3-yl}-3-(3-phenoxyphenyl)propanamide
N-(2-methoxyethyl)-3-{1-[(4-methoxyphenyl)methyl]-1H-indol-3-yl}-3-(3-phenoxyphenyl)propanamide
Compound characteristics
| Compound ID: | V029-5742 |
| Compound Name: | N-(2-methoxyethyl)-3-{1-[(4-methoxyphenyl)methyl]-1H-indol-3-yl}-3-(3-phenoxyphenyl)propanamide |
| Molecular Weight: | 534.66 |
| Molecular Formula: | C34 H34 N2 O4 |
| Salt: | not_available |
| Smiles: | COCCNC(CC(c1cccc(c1)Oc1ccccc1)c1cn(Cc2ccc(cc2)OC)c2ccccc12)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 6.107 |
| logD: | 6.107 |
| logSw: | -5.6389 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 48.646 |
| InChI Key: | TUOMBRWSJWMTRI-WJOKGBTCSA-N |