3-{4-[(2,4-difluorophenyl)methoxy]-3-methoxyphenyl}-5-(2-fluorophenyl)-1,2,4-oxadiazole
Chemical Structure Depiction of
3-{4-[(2,4-difluorophenyl)methoxy]-3-methoxyphenyl}-5-(2-fluorophenyl)-1,2,4-oxadiazole
3-{4-[(2,4-difluorophenyl)methoxy]-3-methoxyphenyl}-5-(2-fluorophenyl)-1,2,4-oxadiazole
Compound characteristics
| Compound ID: | V029-5835 |
| Compound Name: | 3-{4-[(2,4-difluorophenyl)methoxy]-3-methoxyphenyl}-5-(2-fluorophenyl)-1,2,4-oxadiazole |
| Molecular Weight: | 412.37 |
| Molecular Formula: | C22 H15 F3 N2 O3 |
| Salt: | not_available |
| Smiles: | COc1cc(ccc1OCc1ccc(cc1F)F)c1nc(c2ccccc2F)on1 |
| Stereo: | ACHIRAL |
| logP: | 5.3565 |
| logD: | 5.3565 |
| logSw: | -5.4791 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 46.589 |
| InChI Key: | UNYVVYCBOMZOJJ-UHFFFAOYSA-N |