N-tert-butyl-N-(2-{[(furan-2-yl)methyl][(oxolan-2-yl)methyl]amino}-2-oxoethyl)pentanamide
Chemical Structure Depiction of
N-tert-butyl-N-(2-{[(furan-2-yl)methyl][(oxolan-2-yl)methyl]amino}-2-oxoethyl)pentanamide
N-tert-butyl-N-(2-{[(furan-2-yl)methyl][(oxolan-2-yl)methyl]amino}-2-oxoethyl)pentanamide
Compound characteristics
| Compound ID: | V029-6056 |
| Compound Name: | N-tert-butyl-N-(2-{[(furan-2-yl)methyl][(oxolan-2-yl)methyl]amino}-2-oxoethyl)pentanamide |
| Molecular Weight: | 378.51 |
| Molecular Formula: | C21 H34 N2 O4 |
| Smiles: | CCCCC(N(CC(N(CC1CCCO1)Cc1ccco1)=O)C(C)(C)C)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 2.8892 |
| logD: | 2.8892 |
| logSw: | -2.8517 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 48.387 |
| InChI Key: | MORXCTBTUCOEBT-GOSISDBHSA-N |