1-(2,3-dichlorobenzene-1-sulfonyl)-4-[5-(4-ethylpiperazine-1-sulfonyl)-2-methoxyphenyl]piperazine
Chemical Structure Depiction of
1-(2,3-dichlorobenzene-1-sulfonyl)-4-[5-(4-ethylpiperazine-1-sulfonyl)-2-methoxyphenyl]piperazine
1-(2,3-dichlorobenzene-1-sulfonyl)-4-[5-(4-ethylpiperazine-1-sulfonyl)-2-methoxyphenyl]piperazine
Compound characteristics
| Compound ID: | V029-6198 |
| Compound Name: | 1-(2,3-dichlorobenzene-1-sulfonyl)-4-[5-(4-ethylpiperazine-1-sulfonyl)-2-methoxyphenyl]piperazine |
| Molecular Weight: | 577.55 |
| Molecular Formula: | C23 H30 Cl2 N4 O5 S2 |
| Salt: | not_available |
| Smiles: | CCN1CCN(CC1)S(c1ccc(c(c1)N1CCN(CC1)S(c1cccc(c1[Cl])[Cl])(=O)=O)OC)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 3.813 |
| logD: | 3.7263 |
| logSw: | -4.4461 |
| Hydrogen bond acceptors count: | 12 |
| Polar surface area: | 77.787 |
| InChI Key: | PZQRHURGCWQSDQ-UHFFFAOYSA-N |