2-methoxy-5-{[N-(2-methoxyethyl)-2-methylpropanamido]methyl}phenyl 3-(trifluoromethyl)benzene-1-sulfonate
Chemical Structure Depiction of
2-methoxy-5-{[N-(2-methoxyethyl)-2-methylpropanamido]methyl}phenyl 3-(trifluoromethyl)benzene-1-sulfonate
2-methoxy-5-{[N-(2-methoxyethyl)-2-methylpropanamido]methyl}phenyl 3-(trifluoromethyl)benzene-1-sulfonate
Compound characteristics
| Compound ID: | V029-6678 |
| Compound Name: | 2-methoxy-5-{[N-(2-methoxyethyl)-2-methylpropanamido]methyl}phenyl 3-(trifluoromethyl)benzene-1-sulfonate |
| Molecular Weight: | 489.51 |
| Molecular Formula: | C22 H26 F3 N O6 S |
| Smiles: | CC(C)C(N(CCOC)Cc1ccc(c(c1)OS(c1cccc(c1)C(F)(F)F)(=O)=O)OC)=O |
| Stereo: | ACHIRAL |
| logP: | 3.6215 |
| logD: | 3.6215 |
| logSw: | -3.8753 |
| Hydrogen bond acceptors count: | 9 |
| Polar surface area: | 68.52 |
| InChI Key: | SSDGREVTPIFYPL-UHFFFAOYSA-N |